* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5833554 |
| English Synonyms: | ABAMACHEM ABA-5833554 |
| MDL Number.: | MFCD17973824 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1c(cc(o1)CN)CN2CCS(=O)(=O)CC2 |
| InChi: | InChI=1S/C11H18N2O3S/c1-9-10(6-11(7-12)16-9)8-13-2-4-17(14,15)5-3-13/h6H,2-5,7-8,12H2,1H3 |
| InChiKey: | InChIKey=XBJASJOVZKCIME-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.