* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5834425 |
| English Synonyms: | ABAMACHEM ABA-5834425 |
| MDL Number.: | MFCD17974695 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)CNCCCN1CCOC2C1CCC2 |
| InChi: | InChI=1S/C14H28N2O/c1-12(2)11-15-7-4-8-16-9-10-17-14-6-3-5-13(14)16/h12-15H,3-11H2,1-2H3 |
| InChiKey: | InChIKey=AKYAWJNWQXGNSF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.