* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5852104 |
English Synonyms: | ABAMACHEM ABA-5852104 |
MDL Number.: | MFCD17992877 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCc1nccn1CCNCc2ccccc2 |
InChi: | InChI=1S/C14H19N3/c1-2-14-16-9-11-17(14)10-8-15-12-13-6-4-3-5-7-13/h3-7,9,11,15H,2,8,10,12H2,1H3 |
InChiKey: | InChIKey=XFIZGUPYWMJBHO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.