* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5852105 |
English Synonyms: | ABAMACHEM ABA-5852105 |
MDL Number.: | MFCD17992878 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1nccn1CCNC(C)C2CCCO2 |
InChi: | InChI=1S/C13H23N3O/c1-3-13-15-7-9-16(13)8-6-14-11(2)12-5-4-10-17-12/h7,9,11-12,14H,3-6,8,10H2,1-2H3 |
InChiKey: | InChIKey=LIFKPVMEQQCSPI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.