* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5852107 |
English Synonyms: | ABAMACHEM ABA-5852107 |
MDL Number.: | MFCD17992880 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1nccn1C(C)CNCc2ccco2 |
InChi: | InChI=1S/C13H19N3O/c1-3-13-15-6-7-16(13)11(2)9-14-10-12-5-4-8-17-12/h4-8,11,14H,3,9-10H2,1-2H3 |
InChiKey: | InChIKey=HSODXFYUFVQQSR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.