* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5852109 |
English Synonyms: | ABAMACHEM ABA-5852109 |
MDL Number.: | MFCD17992882 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCc1nccn1CCNCCc2cccs2 |
InChi: | InChI=1S/C13H19N3S/c1-2-13-15-8-10-16(13)9-7-14-6-5-12-4-3-11-17-12/h3-4,8,10-11,14H,2,5-7,9H2,1H3 |
InChiKey: | InChIKey=WXKLNOKNYKLBJF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.