* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5852110 |
English Synonyms: | ABAMACHEM ABA-5852110 |
MDL Number.: | MFCD17992883 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1nccn1CCNCCCOC(C)C |
InChi: | InChI=1S/C13H25N3O/c1-4-13-15-8-10-16(13)9-7-14-6-5-11-17-12(2)3/h8,10,12,14H,4-7,9,11H2,1-3H3 |
InChiKey: | InChIKey=XEOBCWQXODZHGR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.