* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5852136 |
| English Synonyms: | ABAMACHEM ABA-5852136 |
| MDL Number.: | MFCD17992909 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)NCCCCn1ccnc1c2cccs2 |
| InChi: | InChI=1S/C14H21N3S/c1-12(2)15-7-3-4-9-17-10-8-16-14(17)13-6-5-11-18-13/h5-6,8,10-12,15H,3-4,7,9H2,1-2H3 |
| InChiKey: | InChIKey=XAICREMKBFUQHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.