* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5852370 |
| English Synonyms: | ABAMACHEM ABA-5852370 |
| MDL Number.: | MFCD17993139 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC1CC=CCC1COCCNC(C)C(C)C |
| InChi: | InChI=1S/C15H29NO/c1-12(2)14(4)16-9-10-17-11-15-8-6-5-7-13(15)3/h5-6,12-16H,7-11H2,1-4H3 |
| InChiKey: | InChIKey=YYDNTYRNRRXPEL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.