* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5852385 |
| English Synonyms: | ABAMACHEM ABA-5852385 |
| MDL Number.: | MFCD17993154 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCC(C)NCCOc1ccccc1/C=C/C |
| InChi: | InChI=1S/C15H23NO/c1-4-8-14-9-6-7-10-15(14)17-12-11-16-13(3)5-2/h4,6-10,13,16H,5,11-12H2,1-3H3/b8-4+ |
| InChiKey: | InChIKey=ZLTOKKRXDWQEQL-XBXARRHUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.