* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5852386 |
English Synonyms: | ABAMACHEM ABA-5852386 |
MDL Number.: | MFCD17993155 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C=C/c1ccccc1OC(C)CNCC=C |
InChi: | InChI=1S/C15H21NO/c1-4-8-14-9-6-7-10-15(14)17-13(3)12-16-11-5-2/h4-10,13,16H,2,11-12H2,1,3H3/b8-4+ |
InChiKey: | InChIKey=YTELXOYVXGYZGZ-XBXARRHUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.