* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5852389 |
| English Synonyms: | ABAMACHEM ABA-5852389 |
| MDL Number.: | MFCD17993158 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C/C=C/c1ccccc1OCCNCC2CCCC2 |
| InChi: | InChI=1S/C17H25NO/c1-2-7-16-10-5-6-11-17(16)19-13-12-18-14-15-8-3-4-9-15/h2,5-7,10-11,15,18H,3-4,8-9,12-14H2,1H3/b7-2+ |
| InChiKey: | InChIKey=UVBURWDIGUUXAB-FARCUNLSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.