* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5852392 |
English Synonyms: | ABAMACHEM ABA-5852392 |
MDL Number.: | MFCD17993161 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCCCNCCOc1ccccc1/C=C/C |
InChi: | InChI=1S/C16H25NO/c1-3-5-8-12-17-13-14-18-16-11-7-6-10-15(16)9-4-2/h4,6-7,9-11,17H,3,5,8,12-14H2,1-2H3/b9-4+ |
InChiKey: | InChIKey=PVFRSXSRFPVISE-RUDMXATFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.