* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5853594 |
English Synonyms: | ABAMACHEM ABA-5853594 |
MDL Number.: | MFCD17994276 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | COc1ccc(cc1)SCCNCc2ccoc2 |
InChi: | InChI=1S/C14H17NO2S/c1-16-13-2-4-14(5-3-13)18-9-7-15-10-12-6-8-17-11-12/h2-6,8,11,15H,7,9-10H2,1H3 |
InChiKey: | InChIKey=ZKIXPRVZBRQZBJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.