* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5854131 |
English Synonyms: | ABAMACHEM ABA-5854131 |
MDL Number.: | MFCD17994812 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CNC(=O)CCn1cc(nn1)C(=O)C(F)(F)F |
InChi: | InChI=1S/C8H9F3N4O2/c1-12-6(16)2-3-15-4-5(13-14-15)7(17)8(9,10)11/h4H,2-3H2,1H3,(H,12,16) |
InChiKey: | InChIKey=PZCUVZZIZGFTPZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.