* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5854166 |
English Synonyms: | ABAMACHEM ABA-5854166 |
MDL Number.: | MFCD17994847 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCNCC1CCCN1CCn2ccnc2C |
InChi: | InChI=1S/C13H24N4/c1-3-14-11-13-5-4-7-17(13)10-9-16-8-6-15-12(16)2/h6,8,13-14H,3-5,7,9-11H2,1-2H3 |
InChiKey: | InChIKey=JUOLOUQEUXAXRT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.