* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5854241 |
| English Synonyms: | ABAMACHEM ABA-5854241 |
| MDL Number.: | MFCD17994922 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | COCCNCC1CCCN1CCn2cccn2 |
| InChi: | InChI=1S/C13H24N4O/c1-18-11-6-14-12-13-4-2-7-16(13)9-10-17-8-3-5-15-17/h3,5,8,13-14H,2,4,6-7,9-12H2,1H3 |
| InChiKey: | InChIKey=JEZSFDVSKPICPB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.