* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5854521 |
| English Synonyms: | ABAMACHEM ABA-5854521 |
| MDL Number.: | MFCD17995199 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cn1c(ccn1)NC(=O)c2cccc(c2)CCN |
| InChi: | InChI=1S/C13H16N4O/c1-17-12(6-8-15-17)16-13(18)11-4-2-3-10(9-11)5-7-14/h2-4,6,8-9H,5,7,14H2,1H3,(H,16,18) |
| InChiKey: | InChIKey=KHVLCAQNZYHTFP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.