* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5854673 |
English Synonyms: | ABAMACHEM ABA-5854673 |
MDL Number.: | MFCD17995351 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCn1ccnc1N2CCCC2CNCCOC |
InChi: | InChI=1S/C13H24N4O/c1-3-16-9-6-15-13(16)17-8-4-5-12(17)11-14-7-10-18-2/h6,9,12,14H,3-5,7-8,10-11H2,1-2H3 |
InChiKey: | InChIKey=ATLQGHXVTYFNQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.