* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5855274 |
| English Synonyms: | ABAMACHEM ABA-5855274 |
| MDL Number.: | MFCD17995649 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCc1ccc(cc1)S(=O)(=O)NCCC#N |
| InChi: | InChI=1S/C12H16N2O2S/c1-2-4-11-5-7-12(8-6-11)17(15,16)14-10-3-9-13/h5-8,14H,2-4,10H2,1H3 |
| InChiKey: | InChIKey=LOYOWLZUNONSLT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.