* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5855275 |
| English Synonyms: | ABAMACHEM ABA-5855275 |
| MDL Number.: | MFCD17995650 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | c1cc(c(cc1S(=O)(=O)NCCC#N)[N+](=O)[O-])F |
| InChi: | InChI=1S/C9H8FN3O4S/c10-8-3-2-7(6-9(8)13(14)15)18(16,17)12-5-1-4-11/h2-3,6,12H,1,5H2 |
| InChiKey: | InChIKey=VMFKWSOEJMOPES-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.