* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5856248 |
English Synonyms: | ABAMACHEM ABA-5856248 |
MDL Number.: | MFCD17995948 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1ccn(c(=O)c1)CC(=O)N2CCC(CC2)C(=O)O |
InChi: | InChI=1S/C13H16N2O4/c16-11-3-1-2-6-15(11)9-12(17)14-7-4-10(5-8-14)13(18)19/h1-3,6,10H,4-5,7-9H2,(H,18,19) |
InChiKey: | InChIKey=ICJRBXLBSMOALK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.