* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5856772 |
| English Synonyms: | ABAMACHEM ABA-5856772 |
| MDL Number.: | MFCD17996265 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CCN(CCC1CCCNC1)Cc2cccs2 |
| InChi: | InChI=1S/C14H24N2S/c1-2-16(12-14-6-4-10-17-14)9-7-13-5-3-8-15-11-13/h4,6,10,13,15H,2-3,5,7-9,11-12H2,1H3 |
| InChiKey: | InChIKey=OSUXXTIADMWRDD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.