* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5857328 |
English Synonyms: | ABAMACHEM ABA-5857328 |
MDL Number.: | MFCD17996794 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | COCCC(=O)Nc1ncc(s1)/C=C/C(=O)O |
InChi: | InChI=1S/C10H12N2O4S/c1-16-5-4-8(13)12-10-11-6-7(17-10)2-3-9(14)15/h2-3,6H,4-5H2,1H3,(H,14,15)(H,11,12,13)/b3-2+ |
InChiKey: | InChIKey=ULVMEFKCZYPEIE-NSCUHMNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.