* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5857371 |
| English Synonyms: | ABAMACHEM ABA-5857371 |
| MDL Number.: | MFCD17996837 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CCOCCC(=O)NC1CC[C@H]2CNC[C@H]2C1 |
| InChi: | InChI=1S/C13H24N2O2/c1-2-17-6-5-13(16)15-12-4-3-10-8-14-9-11(10)7-12/h10-12,14H,2-9H2,1H3,(H,15,16)/t10-,11+,12?/m0/s1 |
| InChiKey: | InChIKey=DGXWCZBRDMYEHK-WIKAKEFZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.