* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5857417 |
| English Synonyms: | ABAMACHEM ABA-5857417 |
| MDL Number.: | MFCD17996881 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | CCOCCC(=O)NC(C1CCCCC1)/C(=N/O)/N |
| InChi: | InChI=1S/C13H25N3O3/c1-2-19-9-8-11(17)15-12(13(14)16-18)10-6-4-3-5-7-10/h10,12,18H,2-9H2,1H3,(H2,14,16)(H,15,17) |
| InChiKey: | InChIKey=PAIVIIKBNOHECE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.