* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5859356 |
| English Synonyms: | ABAMACHEM ABA-5859356 |
| MDL Number.: | MFCD17998803 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCNC(Cc1ccccc1C)Cc2cc(cs2)Br |
| InChi: | InChI=1S/C16H20BrNS/c1-3-18-15(10-16-9-14(17)11-19-16)8-13-7-5-4-6-12(13)2/h4-7,9,11,15,18H,3,8,10H2,1-2H3 |
| InChiKey: | InChIKey=MXYGFZHVCJUXJZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.