* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5860403 |
| English Synonyms: | ABAMACHEM ABA-5860403 |
| MDL Number.: | MFCD17999846 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC1c2ccsc2CCN1CC3CCCC3O |
| InChi: | InChI=1S/C14H21NOS/c1-10-12-6-8-17-14(12)5-7-15(10)9-11-3-2-4-13(11)16/h6,8,10-11,13,16H,2-5,7,9H2,1H3 |
| InChiKey: | InChIKey=JOGNSCQOVNDREV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.