* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5862260 |
| English Synonyms: | ABAMACHEM ABA-5862260 |
| MDL Number.: | MFCD18001647 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | CC(C)NC(=O)CCn1ccc2c1ccc(c2)N |
| InChi: | InChI=1S/C14H19N3O/c1-10(2)16-14(18)6-8-17-7-5-11-9-12(15)3-4-13(11)17/h3-5,7,9-10H,6,8,15H2,1-2H3,(H,16,18) |
| InChiKey: | InChIKey=SDDKOWONDFKTSP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.