* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5863313 |
English Synonyms: | ABAMACHEM ABA-5863313 |
MDL Number.: | MFCD18002696 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCC(c1ccco1)NCCCOCC(C)C |
InChi: | InChI=1S/C14H25NO2/c1-4-13(14-7-5-10-17-14)15-8-6-9-16-11-12(2)3/h5,7,10,12-13,15H,4,6,8-9,11H2,1-3H3 |
InChiKey: | InChIKey=PVMROIKUZRBRNA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.