* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5864377 |
| English Synonyms: | ABAMACHEM ABA-5864377 |
| MDL Number.: | MFCD18003754 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | c1c(cc(c(c1F)S(=O)(=O)NCCCC(=S)N)F)F |
| InChi: | InChI=1S/C10H11F3N2O2S2/c11-6-4-7(12)10(8(13)5-6)19(16,17)15-3-1-2-9(14)18/h4-5,15H,1-3H2,(H2,14,18) |
| InChiKey: | InChIKey=PGRFPVAKBHDACX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.