* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5864384 |
English Synonyms: | ABAMACHEM ABA-5864384 |
MDL Number.: | MFCD18003761 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | C1CS(=O)(=O)CCC1S(=O)(=O)NCCCC(=S)N |
InChi: | InChI=1S/C9H18N2O4S3/c10-9(16)2-1-5-11-18(14,15)8-3-6-17(12,13)7-4-8/h8,11H,1-7H2,(H2,10,16) |
InChiKey: | InChIKey=QGZMFPLPLSSCBT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.