* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABAMACHEM ABA-5864385 |
English Synonyms: | ABAMACHEM ABA-5864385 |
MDL Number.: | MFCD18003762 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCCc1ccc(cc1)S(=O)(=O)NCCCC(=S)N |
InChi: | InChI=1S/C13H20N2O2S2/c1-2-4-11-6-8-12(9-7-11)19(16,17)15-10-3-5-13(14)18/h6-9,15H,2-5,10H2,1H3,(H2,14,18) |
InChiKey: | InChIKey=BTXYWNWRKHKPJL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.