* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABAMACHEM ABA-5864659 |
English Synonyms: | ABAMACHEM ABA-5864659 |
MDL Number.: | MFCD18004017 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | c1cc(cc(c1)O)CC(=O)NCC/C(=N\O)/N |
InChi: | InChI=1S/C11H15N3O3/c12-10(14-17)4-5-13-11(16)7-8-2-1-3-9(15)6-8/h1-3,6,15,17H,4-5,7H2,(H2,12,14)(H,13,16) |
InChiKey: | InChIKey=NHGKGBMZNDYAQL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.