* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABAMACHEM ABA-5864660 |
English Synonyms: | ABAMACHEM ABA-5864660 |
MDL Number.: | MFCD18004018 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | CC(CNC(=O)c1ccc(cc1)N(C)C)/C(=N/O)/N |
InChi: | InChI=1S/C13H20N4O2/c1-9(12(14)16-19)8-15-13(18)10-4-6-11(7-5-10)17(2)3/h4-7,9,19H,8H2,1-3H3,(H2,14,16)(H,15,18) |
InChiKey: | InChIKey=UBXJRJKEIUQCOX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.