* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABAMACHEM ABA-5864663 |
English Synonyms: | ABAMACHEM ABA-5864663 |
MDL Number.: | MFCD18004021 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | CC(CNC(=O)c1ccccc1O)/C(=N/O)/N |
InChi: | InChI=1S/C11H15N3O3/c1-7(10(12)14-17)6-13-11(16)8-4-2-3-5-9(8)15/h2-5,7,15,17H,6H2,1H3,(H2,12,14)(H,13,16) |
InChiKey: | InChIKey=DUMJIQNVPVMUQO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.