* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABAMACHEM ABA-5864664 |
English Synonyms: | ABAMACHEM ABA-5864664 |
MDL Number.: | MFCD18004022 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | Cc1ccc(cc1)C(=O)NCC(C)/C(=N/O)/N |
InChi: | InChI=1S/C12H17N3O2/c1-8-3-5-10(6-4-8)12(16)14-7-9(2)11(13)15-17/h3-6,9,17H,7H2,1-2H3,(H2,13,15)(H,14,16) |
InChiKey: | InChIKey=ZBCMEUYETWOLED-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.