* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABAMACHEM ABA-5864670 |
English Synonyms: | ABAMACHEM ABA-5864670 |
MDL Number.: | MFCD18004028 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC(CNC(=O)c1cc(ccc1F)F)/C(=N/O)/N |
InChi: | InChI=1S/C11H13F2N3O2/c1-6(10(14)16-18)5-15-11(17)8-4-7(12)2-3-9(8)13/h2-4,6,18H,5H2,1H3,(H2,14,16)(H,15,17) |
InChiKey: | InChIKey=OEJOKVCUGNJRBH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.