* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5864692 |
English Synonyms: | ABAMACHEM ABA-5864692 |
MDL Number.: | MFCD18004050 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC(CNC(=O)c1cc2ccccc2s1)/C(=N/O)/N |
InChi: | InChI=1S/C13H15N3O2S/c1-8(12(14)16-18)7-15-13(17)11-6-9-4-2-3-5-10(9)19-11/h2-6,8,18H,7H2,1H3,(H2,14,16)(H,15,17) |
InChiKey: | InChIKey=IMTAAGNYLJPBMF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.