* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5864700 |
| English Synonyms: | ABAMACHEM ABA-5864700 |
| MDL Number.: | MFCD18004058 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | CC(CNC(=O)Nc1ccccc1)/C(=N/O)/N |
| InChi: | InChI=1S/C11H16N4O2/c1-8(10(12)15-17)7-13-11(16)14-9-5-3-2-4-6-9/h2-6,8,17H,7H2,1H3,(H2,12,15)(H2,13,14,16) |
| InChiKey: | InChIKey=LDRCRTHOOFVRIW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.