* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5864701 |
| English Synonyms: | ABAMACHEM ABA-5864701 |
| MDL Number.: | MFCD18004059 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | CC(CNC(=O)Nc1ccccc1OC)/C(=N/O)/N |
| InChi: | InChI=1S/C12H18N4O3/c1-8(11(13)16-18)7-14-12(17)15-9-5-3-4-6-10(9)19-2/h3-6,8,18H,7H2,1-2H3,(H2,13,16)(H2,14,15,17) |
| InChiKey: | InChIKey=QWFSFDKHRJDLMW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.