* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5864704 |
| English Synonyms: | ABAMACHEM ABA-5864704 |
| MDL Number.: | MFCD18004062 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | Cc1c(c(on1)C)S(=O)(=O)NCC/C(=N/O)/N |
| InChi: | InChI=1S/C8H14N4O4S/c1-5-8(6(2)16-12-5)17(14,15)10-4-3-7(9)11-13/h10,13H,3-4H2,1-2H3,(H2,9,11) |
| InChiKey: | InChIKey=VNLCWSAOERRXKK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.