* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5864989 |
English Synonyms: | ABAMACHEM ABA-5864989 |
MDL Number.: | MFCD18004330 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(Cc1nc(on1)[C@@]23C[C@H]4C[C@@H](C2)C[C@H](C4)C3)N |
InChi: | InChI=1S/C15H23N3O/c1-9(16)2-13-17-14(19-18-13)15-6-10-3-11(7-15)5-12(4-10)8-15/h9-12H,2-8,16H2,1H3/t9?,10-,11+,12-,15- |
InChiKey: | InChIKey=ZHHIFSXBHAHKEP-ALOSIYCRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.