* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5865525 |
| English Synonyms: | ABAMACHEM ABA-5865525 |
| MDL Number.: | MFCD18004863 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(s1)CNCCSc2cccc(c2)Cl |
| InChi: | InChI=1S/C14H16ClNS2/c1-11-5-6-14(18-11)10-16-7-8-17-13-4-2-3-12(15)9-13/h2-6,9,16H,7-8,10H2,1H3 |
| InChiKey: | InChIKey=GNHFUIHKDKWMFK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.