* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5865791 |
English Synonyms: | ABAMACHEM ABA-5865791 |
MDL Number.: | MFCD18005123 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(c(c(c1)F)F)C(=O)NC2CCS(=O)(=O)CC2 |
InChi: | InChI=1S/C12H13F2NO3S/c13-10-3-1-2-9(11(10)14)12(16)15-8-4-6-19(17,18)7-5-8/h1-3,8H,4-7H2,(H,15,16) |
InChiKey: | InChIKey=HCNIVXBQISRIOC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.