* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABAMACHEM ABA-5866062 |
English Synonyms: | ABAMACHEM ABA-5866062 |
MDL Number.: | MFCD18005393 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1cc(on1)CNC(=O)c2cccc(c2NC)F |
InChi: | InChI=1S/C13H14FN3O2/c1-8-6-9(19-17-8)7-16-13(18)10-4-3-5-11(14)12(10)15-2/h3-6,15H,7H2,1-2H3,(H,16,18) |
InChiKey: | InChIKey=ADOGQRBKGUWSMD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.