* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5866322 |
| English Synonyms: | ABAMACHEM ABA-5866322 |
| MDL Number.: | MFCD18005652 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CCCn1c(nnn1)CN2CCCCC2C=O |
| InChi: | InChI=1S/C11H19N5O/c1-2-6-16-11(12-13-14-16)8-15-7-4-3-5-10(15)9-17/h9-10H,2-8H2,1H3 |
| InChiKey: | InChIKey=APMGMOALVANREF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.