* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5867098 |
English Synonyms: | ABAMACHEM ABA-5867098 |
MDL Number.: | MFCD18006425 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCCn1cc(nc1C)S(=O)(=O)NCCNC2CC2 |
InChi: | InChI=1S/C12H22N4O2S/c1-3-8-16-9-12(15-10(16)2)19(17,18)14-7-6-13-11-4-5-11/h9,11,13-14H,3-8H2,1-2H3 |
InChiKey: | InChIKey=HWGJPVUREUMGEG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.