* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5867375 |
English Synonyms: | ABAMACHEM ABA-5867375 |
MDL Number.: | MFCD18006698 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cc(cnc1)CC(=O)Nc2nc(cs2)CC(=O)O |
InChi: | InChI=1S/C12H11N3O3S/c16-10(4-8-2-1-3-13-6-8)15-12-14-9(7-19-12)5-11(17)18/h1-3,6-7H,4-5H2,(H,17,18)(H,14,15,16) |
InChiKey: | InChIKey=JMSVZSITDHPJMM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.