* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ABAMACHEM ABA-5867911 |
English Synonyms: | ABAMACHEM ABA-5867911 |
MDL Number.: | MFCD18007223 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(CNC(=O)c1ccc(cc1Cl)Br)C(=O)O |
InChi: | InChI=1S/C11H11BrClNO3/c1-6(11(16)17)5-14-10(15)8-3-2-7(12)4-9(8)13/h2-4,6H,5H2,1H3,(H,14,15)(H,16,17) |
InChiKey: | InChIKey=XTVPUEYQCMCRLO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.